EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27NO2 |
| Net Charge | 0 |
| Average Mass | 313.441 |
| Monoisotopic Mass | 313.20418 |
| SMILES | COc1ccc(C(CCCc2ccccc2)N(C)C)cc1OC |
| InChI | InChI=1S/C20H27NO2/c1-21(2)18(12-8-11-16-9-6-5-7-10-16)17-13-14-19(22-3)20(15-17)23-4/h5-7,9-10,13-15,18H,8,11-12H2,1-4H3 |
| InChIKey | HEFVRVOEBZDOJU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vetrabutine (CHEBI:177576) is a benzenes (CHEBI:22712) |
| Vetrabutine (CHEBI:177576) is a organic amino compound (CHEBI:50047) |
| IUPAC Name |
|---|
| 1-(3,4-dimethoxyphenyl)-N,N-dimethyl-4-phenylbutan-1-amine |