EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H21ClN2O4 |
| Net Charge | 0 |
| Average Mass | 424.884 |
| Monoisotopic Mass | 424.11898 |
| SMILES | COCc1c(C(=O)OC(C)C)ncc2nc3cccc(Oc4ccc(Cl)cc4)c3c12 |
| InChI | InChI=1S/C23H21ClN2O4/c1-13(2)29-23(27)22-16(12-28-3)20-18(11-25-22)26-17-5-4-6-19(21(17)20)30-15-9-7-14(24)8-10-15/h4-11,13,26H,12H2,1-3H3 |
| InChIKey | SLYDYLLJUXFULK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gedocarnil (CHEBI:177565) has role anxiolytic drug (CHEBI:35474) |
| Gedocarnil (CHEBI:177565) is a β-carbolines (CHEBI:60834) |
| IUPAC Name |
|---|
| propan-2-yl 5-(4-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| INN | Source |
|---|---|
| gedocarnilo | WHO MedNet |
| Synonym | Source |
|---|---|
| Gedocarnil | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:109623-97-4 | ChemIDplus |