EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N2O4 |
| Net Charge | 0 |
| Average Mass | 288.303 |
| Monoisotopic Mass | 288.11101 |
| SMILES | Cn1c(/C=C/CO)c(CO)c2c1C(=O)C=C(N1CC1)C2=O |
| InChI | InChI=1S/C15H16N2O4/c1-16-10(3-2-6-18)9(8-19)13-14(16)12(20)7-11(15(13)21)17-4-5-17/h2-3,7,18-19H,4-6,8H2,1H3/b3-2+ |
| InChIKey | MXPOCMVWFLDDLZ-NSCUHMNNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Apaziquone (CHEBI:177558) has role antineoplastic agent (CHEBI:35610) |
| Apaziquone (CHEBI:177558) is a indoles (CHEBI:24828) |
| IUPAC Name |
|---|
| 5-(aziridin-1-yl)-3-(hydroxymethyl)-2-[(E)-3-hydroxyprop-1-enyl]-1-methylindole-4,7-dione |
| INNs | Source |
|---|---|
| apazicuona | WHO MedNet |
| apaziquone | WHO MedNet |
| Synonyms | Source |
|---|---|
| EO-9 | ChEMBL |
| EO9 | ChEMBL |
| Eoquin | ChEMBL |
| NOR-701 | ChEMBL |
| NSC-382456 | ChEMBL |
| NSC-382459 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:114560-48-4 | ChemIDplus |
| Citations |
|---|