EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17755 - cystathionine
| Formula | C7H14N2O4S |
| Net Charge | 0 |
| Average Mass | 222.266 |
| Monoisotopic Mass | 222.06743 |
| SMILES | NC(CCSCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13) |
| InChIKey | ILRYLPWNYFXEMH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cystathionine (CHEBI:17755) has role metabolite (CHEBI:25212) |
| cystathionine (CHEBI:17755) is a cystathionines (CHEBI:23505) |
| cystathionine (CHEBI:17755) is a organic sulfide (CHEBI:16385) |
| Incoming Relation(s) |
| L-cystathionine (CHEBI:17482) is a cystathionine (CHEBI:17755) |
| IUPAC Names |
|---|
| S-(2-amino-2-carboxyethyl)homocysteine |
| 2-amino-4-[(2-amino-2-carboxyethyl)sulfanyl]butanoic acid |
| Synonyms | Source |
|---|---|
| Cystathionine | KEGG COMPOUND |
| DL-Cystathionine | ChemIDplus |
| cystathione | ChEBI |
| Citations |
|---|