EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H33FN6O3 |
| Net Charge | 0 |
| Average Mass | 604.686 |
| Monoisotopic Mass | 604.25982 |
| SMILES | CN1CCC[C@H]1CCNC(=O)c1cn2c3c(c(N4CCC(c5cnccn5)C4)c(F)cc3c1=O)Oc1cc3ccccc3cc1-2 |
| InChI | InChI=1S/C35H33FN6O3/c1-40-13-4-7-24(40)8-10-39-35(44)26-20-42-29-15-21-5-2-3-6-22(21)16-30(29)45-34-31(42)25(33(26)43)17-27(36)32(34)41-14-9-23(19-41)28-18-37-11-12-38-28/h2-3,5-6,11-12,15-18,20,23-24H,4,7-10,13-14,19H2,1H3,(H,39,44)/t23?,24-/m0/s1 |
| InChIKey | WOQIDNWTQOYDLF-CGAIIQECSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. topoisomerase II inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase II. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| itarnafloxin (CHEBI:177533) has role antimalarial (CHEBI:38068) |
| itarnafloxin (CHEBI:177533) has role antineoplastic agent (CHEBI:35610) |
| itarnafloxin (CHEBI:177533) has role apoptosis inducer (CHEBI:68495) |
| itarnafloxin (CHEBI:177533) has role topoisomerase II inhibitor (CHEBI:156203) |
| itarnafloxin (CHEBI:177533) is a N-alkylpyrrolidine (CHEBI:46775) |
| itarnafloxin (CHEBI:177533) is a organic heteropentacyclic compound (CHEBI:38164) |
| itarnafloxin (CHEBI:177533) is a organofluorine compound (CHEBI:37143) |
| itarnafloxin (CHEBI:177533) is a phenoxazine (CHEBI:25970) |
| itarnafloxin (CHEBI:177533) is a pyrazines (CHEBI:38314) |
| itarnafloxin (CHEBI:177533) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 5-fluoro-N-{2-[(2S)-1-methylpyrrolidin-2-yl]ethyl}-3-oxo-6-[3-(pyrazin-2-yl)pyrrolidin-1-yl]-3H-benzo[b]pyrido[3,2,1-kl]phenoxazine-2-carboxamide |
| INNs | Source |
|---|---|
| itarnafloxin | WHO MedNet |
| itarnafloxinum | WHO MedNet |
| itarnafloxine | WHO MedNet |
| itarnafloxina | WHO MedNet |
| Synonyms | Source |
|---|---|
| CX 3543 | DrugBank |
| CX-3543 | DrugBank |
| CX3543 | ChEBI |
| quarfloxin | DrugBank |
| quarfloxacin | ChEBI |
| 5-fluoro-N-(2-((S)-1-methylpyrrolidin-2-yl)ethyl)-3-oxo-6-((R)-3-(pyrazin-2-yl)pyrrolidin-1-yl)-3H-benzo[b]pyrido[3,2,1-kl]phenoxazine-2-carboxamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB06638 | DrugBank |
| 9810507 | ChemSpider |
| D08981 | KEGG DRUG |
| US20060029950 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:865311-47-3 | DrugBank |
| Citations |
|---|