EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O6S2 |
| Net Charge | 0 |
| Average Mass | 414.505 |
| Monoisotopic Mass | 414.09193 |
| SMILES | CC1(C)SCCN(S(=O)(=O)c2ccc(OCC#CCO)cc2)[C@H]1C(=O)NO |
| InChI | InChI=1S/C17H22N2O6S2/c1-17(2)15(16(21)18-22)19(9-12-26-17)27(23,24)14-7-5-13(6-8-14)25-11-4-3-10-20/h5-8,15,20,22H,9-12H2,1-2H3,(H,18,21)/t15-/m0/s1 |
| InChIKey | MAVDNGWEBZTACC-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Apratastat (CHEBI:177520) has role antirheumatic drug (CHEBI:35842) |
| Apratastat (CHEBI:177520) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| (3S)-N-hydroxy-4-[4-(4-hydroxybut-2-ynoxy)phenyl]sulonyl-2,2-dimethylthiomorpholine-3-carboxamide |
| INN | Source |
|---|---|
| apratastat | WHO MedNet |
| Synonyms | Source |
|---|---|
| TMI-005 | ChEMBL |
| TMI-05 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:287405-51-0 | ChemIDplus |
| Citations |
|---|