EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23N3O2 |
| Net Charge | 0 |
| Average Mass | 385.467 |
| Monoisotopic Mass | 385.17903 |
| SMILES | O=c1nc2cccc(N3CCN(Cc4cccc(-c5ccccc5)c4)CC3)c2o1 |
| InChI | InChI=1S/C24H23N3O2/c28-24-25-21-10-5-11-22(23(21)29-24)27-14-12-26(13-15-27)17-18-6-4-9-20(16-18)19-7-2-1-3-8-19/h1-11,16H,12-15,17H2,(H,25,28) |
| InChIKey | CYGODHVAJQTCBG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bifeprunox (CHEBI:177517) has role antidepressant (CHEBI:35469) |
| Bifeprunox (CHEBI:177517) has role antipsychotic agent (CHEBI:35476) |
| Bifeprunox (CHEBI:177517) is a biphenyls (CHEBI:22888) |
| IUPAC Name |
|---|
| 7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one |
| INN | Source |
|---|---|
| bifeprunox | WHO MedNet |
| Registry Numbers | Sources |
|---|---|
| CAS:350992-10-8 | ChemIDplus |
| Citations |
|---|