EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO3 |
| Net Charge | 0 |
| Average Mass | 271.316 |
| Monoisotopic Mass | 271.12084 |
| SMILES | [H][C@@]12C=CC(O)C3Oc4c(O)ccc5c4[C@@]31CCN[C@]2([H])C5 |
| InChI | InChI=1S/C16H17NO3/c18-11-3-1-8-7-10-9-2-4-12(19)15-16(9,5-6-17-10)13(8)14(11)20-15/h1-4,9-10,12,15,17-19H,5-7H2/t9-,10+,12?,15?,16-/m0/s1 |
| InChIKey | ONBWJWYUHXVEJS-MNXNZOQKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-Didehydro-4,5-epoxymorphinan-3,6-diol (CHEBI:177510) is a morphinane alkaloid (CHEBI:25418) |
| IUPAC Name |
|---|
| (4R,4aR,12bS)-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzouro[3,2-e]isoquinoline-7,9-diol |
| Manual Xrefs | Databases |
|---|---|
| 16739390 | ChemSpider |