EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N4O4S |
| Net Charge | 0 |
| Average Mass | 406.508 |
| Monoisotopic Mass | 406.16748 |
| SMILES | COc1ccc(N2CCOCC2)c2sc(NC(=O)N3CCC(C)(O)CC3)nc12 |
| InChI | InChI=1S/C19H26N4O4S/c1-19(25)5-7-23(8-6-19)18(24)21-17-20-15-14(26-2)4-3-13(16(15)28-17)22-9-11-27-12-10-22/h3-4,25H,5-12H2,1-2H3,(H,20,21,24) |
| InChIKey | XNBRWUQWSKXMPW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tozadenant (CHEBI:177494) has role antiparkinson drug (CHEBI:48407) |
| Tozadenant (CHEBI:177494) is a benzothiazoles (CHEBI:37947) |
| IUPAC Name |
|---|
| 4-hydroxy-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-methylpiperidine-1-carboxamide |
| INN | Source |
|---|---|
| tozadenant | WHO MedNet |
| Synonyms | Source |
|---|---|
| A-2A (3) | ChEMBL |
| A2A (3) | ChEMBL |
| A2A-(3) | ChEMBL |
| RO-4494351 | ChEMBL |
| RO4494351 | ChEMBL |
| RO-4494351-000 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:870070-55-6 | ChemIDplus |
| Citations |
|---|