EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H32O5 |
| Net Charge | 0 |
| Average Mass | 304.427 |
| Monoisotopic Mass | 304.22497 |
| SMILES | O=C(O)CCCCCCCC(O)C(O)CCCCCCO |
| InChI | InChI=1S/C16H32O5/c17-13-9-5-4-7-11-15(19)14(18)10-6-2-1-3-8-12-16(20)21/h14-15,17-19H,1-13H2,(H,20,21) |
| InChIKey | MEHUJCGAYMDLEL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aleuretic Acid (CHEBI:177476) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 9,10,16-trihydroxyhexadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 10334 | ChemSpider |
| LMFA01050101 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:6949-98-0 | ChemIDplus |