EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28N2O5S |
| Net Charge | 0 |
| Average Mass | 468.575 |
| Monoisotopic Mass | 468.17189 |
| SMILES | CC(C)(C)c1ccc(CN(Cc2cccc(OCC(=O)O)c2)S(=O)(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C25H28N2O5S/c1-25(2,3)21-11-9-19(10-12-21)16-27(33(30,31)23-8-5-13-26-15-23)17-20-6-4-7-22(14-20)32-18-24(28)29/h4-15H,16-18H2,1-3H3,(H,28,29) |
| InChIKey | WOHRHWDYFNWPNG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| evatanepag (CHEBI:177472) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2-[3-[[(4-tert-butylphenyl)methyl-pyridin-3-ylsulonylamino]methyl]phenoxy]acetic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:223488-57-1 | ChemIDplus |