EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H38O4 |
| Net Charge | 0 |
| Average Mass | 390.564 |
| Monoisotopic Mass | 390.27701 |
| SMILES | CCCCC(CC)COC(=O)c1ccccc1C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C24H38O4/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3 |
| InChIKey | BJQHLKABXJIVAM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | androstane receptor agonist An agonist that selectively binds to and activates androstane receptors. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | plasticiser Any compound that is used as an additive to increase the plasticity or fluidity of a substance, particularly but not exclusively to synthetic polymers. endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis(2-ethylhexyl) phthalate (CHEBI:17747) has role androstane receptor agonist (CHEBI:77326) |
| bis(2-ethylhexyl) phthalate (CHEBI:17747) has role apoptosis inhibitor (CHEBI:68494) |
| bis(2-ethylhexyl) phthalate (CHEBI:17747) has role plasticiser (CHEBI:79056) |
| bis(2-ethylhexyl) phthalate (CHEBI:17747) is a diester (CHEBI:51307) |
| bis(2-ethylhexyl) phthalate (CHEBI:17747) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| bis(2-ethylhexyl) benzene-1,2-dicarboxylate |
| Synonyms | Source |
|---|---|
| Bis(2-ethylhexyl)phthalate | KEGG COMPOUND |
| Dioctyl phthalate | KEGG COMPOUND |
| Diethylhexyl phthalate | ChemIDplus |
| Di(2-ethylhexyl)phthalate | ChemIDplus |
| DEHP | ChemIDplus |
| Di-sec-octyl phthalate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| bis(2-ethylhexyl)phthalate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C03690 | KEGG COMPOUND |
| BIS2-ETHYLHEXYLPHTHALATE | MetaCyc |
| Bis(2-ethylhexyl)_phthalate | Wikipedia |
| Citations |
|---|