EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N4O2 |
| Net Charge | 0 |
| Average Mass | 310.357 |
| Monoisotopic Mass | 310.14298 |
| SMILES | CCc1nn(CCO)c(CC)c1Oc1cc(C#N)cc(C#N)c1 |
| InChI | InChI=1S/C17H18N4O2/c1-3-15-17(16(4-2)21(20-15)5-6-22)23-14-8-12(10-18)7-13(9-14)11-19/h7-9,22H,3-6H2,1-2H3 |
| InChIKey | MCPUZZJBAHRIPO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lersivirine (CHEBI:177465) has role anti-HIV agent (CHEBI:64946) |
| Lersivirine (CHEBI:177465) is a aromatic ether (CHEBI:35618) |
| IUPAC Name |
|---|
| 5-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzene-1,3-dicarbonitrile |
| INNs | Source |
|---|---|
| lersivirina | WHO MedNet |
| lersivirine | WHO MedNet |
| Synonyms | Source |
|---|---|
| UK-453,061 | ChEMBL |
| UK-453061 | ChEMBL |
| Citations |
|---|