EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3O5 |
| Net Charge | 0 |
| Average Mass | 333.344 |
| Monoisotopic Mass | 333.13247 |
| SMILES | N[C@H](CCC(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H19N3O5/c17-11(15(21)22)5-6-14(20)19-13(16(23)24)7-9-8-18-12-4-2-1-3-10(9)12/h1-4,8,11,13,18H,5-7,17H2,(H,19,20)(H,21,22)(H,23,24)/t11-,13+/m1/s1 |
| InChIKey | CATMPQFFVNKDEY-YPMHNXCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Golotimod (CHEBI:177459) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2R)-2-amino-5-[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:229305-39-9 | ChemIDplus |