EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32O7S |
| Net Charge | 0 |
| Average Mass | 524.635 |
| Monoisotopic Mass | 524.18687 |
| SMILES | Cc1cc(OCCCS(C)(=O)=O)cc(C)c1-c1cccc(COc2ccc3c(c2)OC[C@H]3CC(=O)O)c1 |
| InChI | InChI=1S/C29H32O7S/c1-19-12-25(34-10-5-11-37(3,32)33)13-20(2)29(19)22-7-4-6-21(14-22)17-35-24-8-9-26-23(15-28(30)31)18-36-27(26)16-24/h4,6-9,12-14,16,23H,5,10-11,15,17-18H2,1-3H3,(H,30,31)/t23-/m1/s1 |
| InChIKey | BZCALJIHZVNMGJ-HSZRJFAPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fasiglifam (CHEBI:177451) has role hypoglycemic agent (CHEBI:35526) |
| Fasiglifam (CHEBI:177451) is a biphenyls (CHEBI:22888) |
| IUPAC Name |
|---|
| 2-[(3S)-6-[[3-[2,6-dimethyl-4-(3-methylsulonylpropoxy)phenyl]phenyl]methoxy]-2,3-dihydro-1-benzouran-3-yl]acetic acid |
| INN | Source |
|---|---|
| fasiglifam | WHO MedNet |
| Synonyms | Source |
|---|---|
| Fasiglifam hemihydrate | ChEMBL |
| Fasiglifam hydrate | ChEMBL |
| TAK-875 | ChEMBL |
| TAK875 | ChEMBL |
| Tak-875 anhydrous | ChEMBL |
| Citations |
|---|