EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O6 |
| Net Charge | 0 |
| Average Mass | 190.151 |
| Monoisotopic Mass | 190.04774 |
| SMILES | O=C1CC(O)(C(=O)O)CC(O)C1O |
| InChI | InChI=1S/C7H10O6/c8-3-1-7(13,6(11)12)2-4(9)5(3)10/h3,5,8,10,13H,1-2H2,(H,11,12) |
| InChIKey | WVMWZWGZRAXUBK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,4-Trihydroxy-5-oxocyclohexanecarboxylic acid (CHEBI:177449) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| 1,3,4-trihydroxy-5-oxocyclohexane-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 610 | ChemSpider |