EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H35N3O5 |
| Net Charge | 0 |
| Average Mass | 433.549 |
| Monoisotopic Mass | 433.25767 |
| SMILES | CCCC[C@H](NC=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C23H35N3O5/c1-5-6-12-18(24-15-27)21(28)25-19(13-16(2)3)22(29)26-20(23(30)31-4)14-17-10-8-7-9-11-17/h7-11,15-16,18-20H,5-6,12-14H2,1-4H3,(H,24,27)(H,25,28)(H,26,29)/t18-,19-,20-/m0/s1 |
| InChIKey | CMDJMPUKVKXWBI-UFYCRDLUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl N-formylnorleucylleucylphenylalaninate (CHEBI:177447) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| methyl (2S)-2-[[(2S)-2-[[(2S)-2-ormamidohexanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate |
| Manual Xrefs | Databases |
|---|---|
| 52564147 | ChemSpider |