EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26ClNO3 |
| Net Charge | 0 |
| Average Mass | 351.874 |
| Monoisotopic Mass | 351.16012 |
| SMILES | [H][C@]12O[C@H](OC)[C@]3([H])[C@@]([H])(C[C@H](NCCc4ccccc4Cl)[C@@]3(C)O1)[C@@H]2C |
| InChI | InChI=1S/C19H26ClNO3/c1-11-13-10-15(21-9-8-12-6-4-5-7-14(12)20)19(2)16(13)18(22-3)23-17(11)24-19/h4-7,11,13,15-18,21H,8-10H2,1-3H3/t11-,13-,15-,16-,17-,18-,19+/m0/s1 |
| InChIKey | LEZRPUQAMHWLNN-PCVUGLTOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2-(2-Chlorophenyl)ethyl)amino-8-methoxy-3,10-dimethyl-2,9-dioxatricyclo(4,3,1,0(3,7))decane (CHEBI:177444) is a primary amine (CHEBI:32877) |
| IUPAC Name |
|---|
| (1R,3S,4S,6S,7R,8S,10S)-N-[2-(2-chlorophenyl)ethyl]-8-methoxy-3,10-dimethyl-2,9-dioxatricyclo[4.3.1.03,7]decan-4-amine |
| Manual Xrefs | Databases |
|---|---|
| 111791 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:68163-03-1 | ChemIDplus |