EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O |
| Net Charge | 0 |
| Average Mass | 276.464 |
| Monoisotopic Mass | 276.24532 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)CCC[C@]43[H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C19H32O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h13-17,20H,3-12H2,1-2H3/t13-,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | DJTOLSNIKJIDFF-LOVVWNRFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5alpha-Androstan-3beta-ol (CHEBI:177437) has role androgen (CHEBI:50113) |
| 5alpha-Androstan-3beta-ol (CHEBI:177437) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (3S,5S,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Manual Xrefs | Databases |
|---|---|
| 83841 | ChemSpider |
| HMDB0005830 | HMDB |
| LMST02020095 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:1224-92-6 | ChemIDplus |