EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19N3O4 |
| Net Charge | 0 |
| Average Mass | 233.268 |
| Monoisotopic Mass | 233.13756 |
| SMILES | N[C@H](CNCCCC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H19N3O4/c10-6(8(13)14)3-1-2-4-12-5-7(11)9(15)16/h6-7,12H,1-5,10-11H2,(H,13,14)(H,15,16)/t6-,7+/m0/s1 |
| InChIKey | IMSOBGJSYSFTKG-NKWVEPMBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LYSINOALANINE, (S,R)- (CHEBI:177434) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| (2S)-2-amino-6-[[(2R)-2-amino-2-carboxyethyl]amino]hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 153716 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:63121-95-9 | ChemIDplus |