EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H19FN2O3 |
| Net Charge | 0 |
| Average Mass | 402.425 |
| Monoisotopic Mass | 402.13797 |
| SMILES | O=C(O)Cn1c2c(c3cc(F)ccc31)CN(C(=O)c1cccc3ccccc13)CC2 |
| InChI | InChI=1S/C24H19FN2O3/c25-16-8-9-21-19(12-16)20-13-26(11-10-22(20)27(21)14-23(28)29)24(30)18-7-3-5-15-4-1-2-6-17(15)18/h1-9,12H,10-11,13-14H2,(H,28,29) |
| InChIKey | IHAXLPDVOWLUOS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Setipiprant (CHEBI:177430) has role anti-asthmatic agent (CHEBI:65023) |
| Setipiprant (CHEBI:177430) is a naphthalenecarboxamide (CHEBI:48739) |
| IUPAC Name |
|---|
| 2-[8-luoro-2-(naphthalene-1-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid |
| INN | Source |
|---|---|
| setipiprant | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACT-129968 | ChEMBL |
| KYTH-105 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:866460-33-5 | ChemIDplus |
| Citations |
|---|