EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O4 |
| Net Charge | 0 |
| Average Mass | 280.324 |
| Monoisotopic Mass | 280.14231 |
| SMILES | CC(C)C(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C14H20N2O4/c1-8(2)12(15)13(18)16-11(14(19)20)7-9-3-5-10(17)6-4-9/h3-6,8,11-12,17H,7,15H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | VEYJKJORLPYVLO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Valyltyrosine (CHEBI:177417) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(2-amino-3-methylbutanoyl)amino]-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 3280382 | ChemSpider |
| HMDB0029139 | HMDB |