EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N4O2 |
| Net Charge | 0 |
| Average Mass | 336.395 |
| Monoisotopic Mass | 336.15863 |
| SMILES | CC(C)(C)c1ncnc1/C=c1\nc(=O)/c(=C/c2ccccc2)nc1=O |
| InChI | InChI=1S/C19H20N4O2/c1-19(2,3)16-13(20-11-21-16)10-15-18(25)22-14(17(24)23-15)9-12-7-5-4-6-8-12/h4-11H,1-3H3,(H,20,21)(H,22,25)(H,23,24)/b14-9-,15-10- |
| InChIKey | UNRCMCRRFYFGFX-TYPNBTCFSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plinabulin (CHEBI:177413) has role angiogenesis inhibitor (CHEBI:48422) |
| plinabulin (CHEBI:177413) has role antineoplastic agent (CHEBI:35610) |
| plinabulin (CHEBI:177413) has role apoptosis inducer (CHEBI:68495) |
| plinabulin (CHEBI:177413) has role microtubule-destabilising agent (CHEBI:61951) |
| plinabulin (CHEBI:177413) is a 2,5-diketopiperazines (CHEBI:65061) |
| plinabulin (CHEBI:177413) is a benzenes (CHEBI:22712) |
| plinabulin (CHEBI:177413) is a imidazoles (CHEBI:24780) |
| plinabulin (CHEBI:177413) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (3Z,6Z)-3-benzylidene-6-[(5-tert-butyl-1H-imidazol-4-yl)methylidene]piperazine-2,5-dione |
| INNs | Source |
|---|---|
| plinabulin | WHO MedNet |
| plinabulina | WHO MedNet |
| plinabuline | WHO MedNet |
| plinabulinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BPI 2358 | ChEBI |
| BPI-2358 | ChEBI |
| NPI 2358 | ChemIDplus |
| NPI-2358 | ChemIDplus |
| NPI2358 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:714272-27-2 | ChemIDplus |
| Citations |
|---|