EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27ClN2 |
| Net Charge | 0 |
| Average Mass | 354.925 |
| Monoisotopic Mass | 354.18628 |
| SMILES | CN1CCN([C@@H]2C[C@@H](c3ccccc3)c3ccc(Cl)cc32)CC1(C)C |
| InChI | InChI=1S/C22H27ClN2/c1-22(2)15-25(12-11-24(22)3)21-14-19(16-7-5-4-6-8-16)18-10-9-17(23)13-20(18)21/h4-10,13,19,21H,11-12,14-15H2,1-3H3/t19-,21+/m0/s1 |
| InChIKey | BYPMJBXPNZMNQD-PZJWPPBQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Zicronapine (CHEBI:177409) has role antipsychotic agent (CHEBI:35476) |
| Zicronapine (CHEBI:177409) is a indanes (CHEBI:46940) |
| IUPAC Name |
|---|
| 4-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazine |
| INNs | Source |
|---|---|
| zicronapina | WHO MedNet |
| zicronapine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Lu 31-130 | ChEMBL |
| LU-31-130 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:170381-16-5 | ChemIDplus |
| Citations |
|---|