EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32N4O4 |
| Net Charge | 0 |
| Average Mass | 416.522 |
| Monoisotopic Mass | 416.24236 |
| SMILES | CCCn1c(=O)c2nc(C34CCC(CCC(=O)O)(CC3)CC4)nc2n(CCC)c1=O |
| InChI | InChI=1S/C22H32N4O4/c1-3-13-25-17-16(18(29)26(14-4-2)20(25)30)23-19(24-17)22-10-7-21(8-11-22,9-12-22)6-5-15(27)28/h3-14H2,1-2H3,(H,23,24)(H,27,28) |
| InChIKey | ZWTVVWUOTJRXKM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | Sausage (ENVO:00002166) | MetaboLights (MTBLS2871) |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tonapofylline (CHEBI:177398) has role cardiovascular drug (CHEBI:35554) |
| Tonapofylline (CHEBI:177398) is a oxopurine (CHEBI:25810) |
| IUPAC Name |
|---|
| 3-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-1-bicyclo[2.2.2]octanyl]propanoic acid |
| INNs | Source |
|---|---|
| tonapofilina | WHO MedNet |
| tonapofylline | WHO MedNet |
| Synonyms | Source |
|---|---|
| BG-9928 | ChEMBL |
| BG9928 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:340021-17-2 | ChemIDplus |
| Citations |
|---|