EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:177375 - Diendiol
| Formula | C21H30O3 |
| Net Charge | 0 |
| Average Mass | 330.468 |
| Monoisotopic Mass | 330.21949 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)C[C@]1(C)/C(=C\CO)CC[C@@]21[H] |
| InChI | InChI=1S/C21H30O3/c1-20-9-7-15(23)11-14(20)3-5-16-17-6-4-13(8-10-22)21(17,2)12-18(24)19(16)20/h8,11,16-19,22,24H,3-7,9-10,12H2,1-2H3/b13-8-/t16-,17-,18-,19+,20-,21+/m0/s1 |
| InChIKey | SBMHTRUNPKWTLU-PKJGFKEFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitis vinifera (ncbitaxon:29760) | Wine (NCIT:C66822) | MetaboLights (MTBLS2330) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Diendiol (CHEBI:177375) has role androgen (CHEBI:50113) |
| Diendiol (CHEBI:177375) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (8S,9S,10R,11S,13S,14S,17Z)-11-hydroxy-17-(2-hydroxyethylidene)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |