EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17Cl2N5O |
| Net Charge | 0 |
| Average Mass | 390.274 |
| Monoisotopic Mass | 389.08102 |
| SMILES | O=C(CN1CCN(c2ccc(Cl)c(Cl)c2)CC1)c1cnc2ncccn12 |
| InChI | InChI=1S/C18H17Cl2N5O/c19-14-3-2-13(10-15(14)20)24-8-6-23(7-9-24)12-17(26)16-11-22-18-21-4-1-5-25(16)18/h1-5,10-11H,6-9,12H2 |
| InChIKey | BZRASUPXGFVMFK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| IMID-2 (CHEBI:177369) has role antineoplastic agent (CHEBI:35610) |
| IMID-2 (CHEBI:177369) is a N-arylpiperazine (CHEBI:46848) |
| IMID-2 (CHEBI:177369) is a aromatic ketone (CHEBI:76224) |
| IMID-2 (CHEBI:177369) is a dichlorobenzene (CHEBI:23697) |
| IMID-2 (CHEBI:177369) is a imidazopyrimidine (CHEBI:35875) |
| IUPAC Name |
|---|
| 2-[4-(3,4-dichlorophenyl)piperazin-1-yl]-1-(imidazo[1,2-a]pyrimidin-3-yl)ethanone |
| Synonym | Source |
|---|---|
| 2-[4-(3,4-dichlorophenyl)piperazin-1-yl]-1-(imidazo[1,2-a]pyrimidin-3-yl)ethan-1-one | IUPAC |
| Citations |
|---|