EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11O6P |
| Net Charge | 0 |
| Average Mass | 198.111 |
| Monoisotopic Mass | 198.02932 |
| SMILES | C[C@](O)(CO)[C@H]1COP(=O)(O)O1 |
| InChI | InChI=1S/C5H11O6P/c1-5(7,3-6)4-2-10-12(8,9)11-4/h4,6-7H,2-3H2,1H3,(H,8,9)/t4-,5+/m1/s1 |
| InChIKey | BOPIGILYBRIHTQ-UHNVWZDZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-C-methyl-D-erythritol 3,4-cyclophosphate (CHEBI:177364) is a tetritol phosphate (CHEBI:26980) |
| 2-C-methyl-D-erythritol 3,4-cyclophosphate (CHEBI:177364) is conjugate acid of 2-C-methyl-D-erythritol 3,4-cyclophosphate(1−) (CHEBI:177365) |
| Incoming Relation(s) |
| 2-C-methyl-D-erythritol 3,4-cyclophosphate(1−) (CHEBI:177365) is conjugate base of 2-C-methyl-D-erythritol 3,4-cyclophosphate (CHEBI:177364) |
| Citations |
|---|