EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7N3O2 |
| Net Charge | 0 |
| Average Mass | 177.163 |
| Monoisotopic Mass | 177.05383 |
| SMILES | CNC1=CC(=O)c2nncc2C1=O |
| InChI | InChI=1S/C8H7N3O2/c1-9-5-2-6(12)7-4(8(5)13)3-10-11-7/h2-3,9H,1H3,(H,10,11) |
| InChIKey | VEHOHPKNNRMFLV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces albus J1074 (ncbitaxon:457425) | - | PubMed (32911655) |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salumycin (CHEBI:177360) has role bacterial metabolite (CHEBI:76969) |
| salumycin (CHEBI:177360) has role radical scavenger (CHEBI:48578) |
| salumycin (CHEBI:177360) is a cyclic ketone (CHEBI:3992) |
| salumycin (CHEBI:177360) is a indazoles (CHEBI:38769) |
| salumycin (CHEBI:177360) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 5-(methylamino)-2H-indazole-4,7-dione |
| Synonym | Source |
|---|---|
| 5-(methylamino)-4,7-dihydro-2H-indazole-4,7-dione | IUPAC |
| Citations |
|---|