EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10BrNO2S |
| Net Charge | 0 |
| Average Mass | 276.155 |
| Monoisotopic Mass | 274.96156 |
| SMILES | N[C@@H](CSc1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C9H10BrNO2S/c10-6-1-3-7(4-2-6)14-5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | JULKRQGCYVMHSB-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(4-bromophenyl)-L-cysteine (CHEBI:17736) is a L-cysteine thioether (CHEBI:27532) |
| S-(4-bromophenyl)-L-cysteine (CHEBI:17736) is a bromoamino acid (CHEBI:22930) |
| S-(4-bromophenyl)-L-cysteine (CHEBI:17736) is tautomer of S-(4-bromophenyl)-L-cysteine zwitterion (CHEBI:58257) |
| Incoming Relation(s) |
| S-(4-bromophenyl)-L-cysteine zwitterion (CHEBI:58257) is tautomer of S-(4-bromophenyl)-L-cysteine (CHEBI:17736) |
| IUPAC Names |
|---|
| (2R)-2-amino-3-[(4-bromophenyl)sulfanyl]propanoic acid |
| S-(4-bromophenyl)-L-cysteine |
| Synonym | Source |
|---|---|
| S-(4-Bromophenyl)-L-cysteine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03900 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3204780 | Beilstein |