EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2O2 |
| Net Charge | 0 |
| Average Mass | 216.240 |
| Monoisotopic Mass | 216.08988 |
| SMILES | CNC1=CC(=O)c2c(cnc(C)c2C)C1=O |
| InChI | InChI=1S/C12H12N2O2/c1-6-7(2)14-5-8-11(6)10(15)4-9(13-3)12(8)16/h4-5,13H,1-3H3 |
| InChIKey | SDLNCVBYFYLESJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces albus J1074 (ncbitaxon:457425) | - | PubMed (30816348) | produced via heterologously introduced biosynthetic gene cluster in a bacterial host. |
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (19921834) | Strain: Mei37 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mansouramycin A (CHEBI:177359) has role antibacterial agent (CHEBI:33282) |
| mansouramycin A (CHEBI:177359) has role bacterial metabolite (CHEBI:76969) |
| mansouramycin A (CHEBI:177359) has role marine metabolite (CHEBI:76507) |
| mansouramycin A (CHEBI:177359) is a p-quinones (CHEBI:25830) |
| mansouramycin A (CHEBI:177359) is a isoquinolines (CHEBI:24922) |
| mansouramycin A (CHEBI:177359) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 3,4-dimethyl-7-(methylamino)isoquinoline-5,8-dione |
| Synonym | Source |
|---|---|
| 7-methylamino-3,4-dimethylisoquinoline-5,8-dione | ChEBI |
| Citations |
|---|