EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO3 |
| Net Charge | 0 |
| Average Mass | 271.316 |
| Monoisotopic Mass | 271.12084 |
| SMILES | Oc1ccc(C[C@@H]2NCCc3cc(O)c(O)cc32)cc1 |
| InChI | InChI=1S/C16H17NO3/c18-12-3-1-10(2-4-12)7-14-13-9-16(20)15(19)8-11(13)5-6-17-14/h1-4,8-9,14,17-20H,5-7H2/t14-/m0/s1 |
| InChIKey | WZRCQWQRFZITDX-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-norcoclaurine (CHEBI:17729) is a norcoclaurine (CHEBI:25591) |
| (S)-norcoclaurine (CHEBI:17729) is conjugate base of (S)-norcoclaurinium(1+) (CHEBI:58253) |
| Incoming Relation(s) |
| (S)-norcoclaurinium(1+) (CHEBI:58253) is conjugate acid of (S)-norcoclaurine (CHEBI:17729) |
| IUPAC Name |
|---|
| (1S)-1-(4-hydroxybenzyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| Synonyms | Source |
|---|---|
| 6,7-Dihydroxy-(1S)-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline | KEGG COMPOUND |
| (S)-Norcoclaurine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06160 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:22672-77-1 | KEGG COMPOUND |