EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N3O3 |
| Net Charge | 0 |
| Average Mass | 275.308 |
| Monoisotopic Mass | 275.12699 |
| SMILES | CC(NC(=O)C(N)Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H17N3O3/c1-8(14(19)20)17-13(18)11(15)6-9-7-16-12-5-3-2-4-10(9)12/h2-5,7-8,11,16H,6,15H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | OHGNSVACHBZKSS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | liver (BTO:0000759) | Article | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tryptophyl-Alanine (CHEBI:177285) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 231457 | ChemSpider |
| HMDB0029076 | HMDB |