EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48O8S |
| Net Charge | 0 |
| Average Mass | 532.740 |
| Monoisotopic Mass | 532.30699 |
| SMILES | CC(CCCC(CO)COS(=O)(=O)O)C1CCC2C3C(O)CC4C[C@H](O)CC[C@]4(C)C3C[C@@H](O)[C@]12C |
| InChI | InChI=1S/C27H48O8S/c1-16(5-4-6-17(14-28)15-35-36(32,33)34)20-7-8-21-25-22(13-24(31)27(20,21)3)26(2)10-9-19(29)11-18(26)12-23(25)30/h16-25,28-31H,4-15H2,1-3H3,(H,32,33,34)/t16?,17?,18?,19-,20?,21?,22?,23?,24-,25?,26+,27-/m1/s1 |
| InChIKey | KAOLEMQCYWHOJQ-JINGCIQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | liver (BTO:0000759) | Article | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5b-Cyprinol sulfate (CHEBI:177282) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| [2-(hydroxymethyl)-6-[(3R,7R,10S,12R,13R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptyl] hydrogen sulate |
| Manual Xrefs | Databases |
|---|---|
| C05468 | KEGG COMPOUND |
| HMDB0006888 | HMDB |