EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O3 |
| Net Charge | 0 |
| Average Mass | 222.284 |
| Monoisotopic Mass | 222.12559 |
| SMILES | CC(C(=O)O)c1ccc(C(O)C(C)C)cc1 |
| InChI | InChI=1S/C13H18O3/c1-8(2)12(14)11-6-4-10(5-7-11)9(3)13(15)16/h4-9,12,14H,1-3H3,(H,15,16) |
| InChIKey | RMOQYHYFRKTDRI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | liver (BTO:0000759) | Article | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-Hydroxyibuprofen (CHEBI:177271) is a benzenes (CHEBI:22712) |
| 1-Hydroxyibuprofen (CHEBI:177271) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2-[4-(1-hydroxy-2-methylpropyl)phenyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 21686528 | ChemSpider |
| HMDB0060565 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:53949-53-4 | ChemIDplus |