EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O4 |
| Net Charge | 0 |
| Average Mass | 162.145 |
| Monoisotopic Mass | 162.06406 |
| SMILES | NCC(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C5H10N2O4/c6-1-4(9)7-3(2-8)5(10)11/h3,8H,1-2,6H2,(H,7,9)(H,10,11) |
| InChIKey | BCCRXDTUTZHDEU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | liver (BTO:0000759) | Article | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glycyl-Serine (CHEBI:177270) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(2-aminoacetyl)amino]-3-hydroxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 92542 | ChemSpider |
| HMDB0028850 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:687-38-7 | ChemIDplus |