EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C8H12N2O4S)n.C2H5NO2 |
| Net Charge | 0 |
| Average Mass | 307.328 |
| Monoisotopic Mass | 307.08381 |
| SMILES | [H]N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | RWSXRVCMGQZWBV-WDSKDSINSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [Glu(-Cys)]n-Gly (CHEBI:17726) is a polymer (CHEBI:60027) |
| [Glu(-Cys)]n-Gly (CHEBI:17726) is conjugate acid of [Glu(-Cys)]n-Gly(1−) (CHEBI:131728) |
| Incoming Relation(s) |
| [Glu(-Cys)]n-Gly(1−) (CHEBI:131728) is conjugate base of [Glu(-Cys)]n-Gly (CHEBI:17726) |
| Synonyms | Source |
|---|---|
| [Glu(-Cys)]n-Gly | KEGG COMPOUND |
| poly(gamma-glutamylcysteine)glycine | ChEBI |
| (gamma-Glutamylcysteine)n-glycine | ChEBI |
| (gamma-Glutamylcysteine)n-glycine | KEGG COMPOUND |
| Poly(gamma-glutamylcysteine)glycine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02471 | KEGG COMPOUND |