EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2O5 |
| Net Charge | 0 |
| Average Mass | 280.280 |
| Monoisotopic Mass | 280.10592 |
| SMILES | NC(Cc1ccccc1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H16N2O5/c14-9(6-8-4-2-1-3-5-8)12(18)15-10(13(19)20)7-11(16)17/h1-5,9-10H,6-7,14H2,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | HWMGTNOVUDIKRE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | liver (BTO:0000759) | Article | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phenylalanyl-Aspartate (CHEBI:177259) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(2-amino-3-phenylpropanoyl)amino]butanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028991 | HMDB |
| 296912 | ChemSpider |