EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | C[C@]12CCC(O)CC1=CCC1C2CC[C@]2(C)C(=O)C(O)CC12 |
| InChI | InChI=1S/C19H28O3/c1-18-7-5-12(20)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(21)17(19)22/h3,12-16,20-21H,4-10H2,1-2H3/t12?,13?,14?,15?,16?,18-,19-/m0/s1 |
| InChIKey | QQIVKFZWLZJXJT-WPISSGQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | liver (BTO:0000759) | Article | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16a-Hydroxydehydroisoandrosterone (CHEBI:177256) has role androgen (CHEBI:50113) |
| 16a-Hydroxydehydroisoandrosterone (CHEBI:177256) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (10R,13S)-3,16-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |