EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O5 |
| Net Charge | 0 |
| Average Mass | 294.307 |
| Monoisotopic Mass | 294.12157 |
| SMILES | NC(Cc1ccccc1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H18N2O5/c15-10(8-9-4-2-1-3-5-9)13(19)16-11(14(20)21)6-7-12(17)18/h1-5,10-11H,6-8,15H2,(H,16,19)(H,17,18)(H,20,21) |
| InChIKey | JXWLMUIXUXLIJR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | liver (BTO:0000759) | Article | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phenylalanyl-Glutamate (CHEBI:177253) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(2-amino-3-phenylpropanoyl)amino]pentanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028994 | HMDB |
| 3622675 | ChemSpider |