EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29F2N5O3 |
| Net Charge | 0 |
| Average Mass | 485.535 |
| Monoisotopic Mass | 485.22385 |
| SMILES | COC(=O)[C@H](CCCNC(=N)N)NC(=O)CCCc1c(-c2ccccc2)nc2c(F)cc(F)cc12 |
| InChI | InChI=1S/C25H29F2N5O3/c1-35-24(34)20(10-6-12-30-25(28)29)31-21(33)11-5-9-17-18-13-16(26)14-19(27)23(18)32-22(17)15-7-3-2-4-8-15/h2-4,7-8,13-14,20,32H,5-6,9-12H2,1H3,(H,31,33)(H4,28,29,30)/t20-/m0/s1 |
| InChIKey | OPNMQSFIGUSHDH-FQEVSTJZSA-N |
| Roles Classification |
|---|
| Biological Role: | somatostatin receptor agonist An agonist that binds to and activates somatostatin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-803087 (CHEBI:177197) has role somatostatin receptor agonist (CHEBI:177023) |
| L-803087 (CHEBI:177197) is a L-arginine derivative (CHEBI:83965) |
| L-803087 (CHEBI:177197) is a benzenes (CHEBI:22712) |
| L-803087 (CHEBI:177197) is a fluoroindole (CHEBI:131960) |
| L-803087 (CHEBI:177197) is a guanidines (CHEBI:24436) |
| L-803087 (CHEBI:177197) is a methyl ester (CHEBI:25248) |
| L-803087 (CHEBI:177197) is a phenylindole (CHEBI:48559) |
| L-803087 (CHEBI:177197) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| methyl N2-[4-(5,7-difluoro-2-phenyl-1H-indol-3-yl)butanoyl]-L-argininate |
| Synonyms | Source |
|---|---|
| methyl (2S)-5-carbamimidamido-2-[4-(5,7-difluoro-2-phenyl-1H-indol-3-yl)butanamido]pentanoate | IUPAC |
| L 803087 | ChEBI |
| L803087 | ChEBI |
| L-803,087 | ChEBI |
| N2-[4-(5,7-difluoro-2-phenyl-1H-indol-3-yl)-1-oxobutyl]-L-arginine methyl ester | ChEBI |
| Citations |
|---|