EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H45BrO2 |
| Net Charge | 0 |
| Average Mass | 457.537 |
| Monoisotopic Mass | 456.26029 |
| SMILES | CCCCCCCCCCCCCCC/C=C\CC/C(Br)=C\CCCC(=O)O |
| InChI | InChI=1S/C25H45BrO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-24(26)22-19-20-23-25(27)28/h16-17,22H,2-15,18-21,23H2,1H3,(H,27,28)/b17-16-,24-22+ |
| InChIKey | VRACWEMNOVUYQJ-YIRKJRPPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos grunniens (ncbitaxon:30521) | subcutaneous adipose tissue (BTO:0004042) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-bromo-pentacosa-5E,9Z-dienoic acid (CHEBI:177109) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (5E,9Z)-6-bromopentacosa-5,9-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 10473984 | ChemSpider |
| LMFA01090103 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:150994-71-1 | ChemIDplus |