EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3O3 |
| Net Charge | 0 |
| Average Mass | 301.346 |
| Monoisotopic Mass | 301.14264 |
| SMILES | NC(Cc1cnc2ccccc12)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C16H19N3O3/c17-12(15(20)19-7-3-6-14(19)16(21)22)8-10-9-18-13-5-2-1-4-11(10)13/h1-2,4-5,9,12,14,18H,3,6-8,17H2,(H,21,22) |
| InChIKey | DXYQIGZZWYBXSD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos grunniens (ncbitaxon:30521) | subcutaneous adipose tissue (BTO:0004042) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tryptophyl-Proline (CHEBI:177093) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 1-[2-amino-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 10442085 | ChemSpider |
| HMDB0029091 | HMDB |