EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5F7O2 |
| Net Charge | 0 |
| Average Mass | 242.090 |
| Monoisotopic Mass | 242.01778 |
| SMILES | O=C(O)CCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F7O2/c7-4(8,2-1-3(14)15)5(9,10)6(11,12)13/h1-2H2,(H,14,15) |
| InChIKey | ISFKSWMQWIRDNC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 33FTA (CHEBI:177060) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 4,4,5,5,6,6,6-heptaluorohexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 2055285 | ChemSpider |