EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N4O5 |
| Net Charge | 0 |
| Average Mass | 274.277 |
| Monoisotopic Mass | 274.12772 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18N4O5/c11-10(12)13-5-1-2-6(9(18)19)14-7(15)3-4-8(16)17/h6H,1-5H2,(H,14,15)(H,16,17)(H,18,19)(H4,11,12,13)/t6-/m0/s1 |
| InChIKey | UMOXFSXIFQOWTD-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Schizosaccharomyces pombe 972h- (ncbitaxon:284812) | |||
| - | DOI (10.3390/metabo3041118) | ||
| - | MetaboLights (MTBLS67) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-succinyl-L-arginine (CHEBI:17705) has role Escherichia coli metabolite (CHEBI:76971) |
| N2-succinyl-L-arginine (CHEBI:17705) is a N-acyl-L-arginine (CHEBI:21645) |
| N2-succinyl-L-arginine (CHEBI:17705) is conjugate acid of N2-(3-carboxylatopropionyl)-L-arginine(1−) (CHEBI:58241) |
| Incoming Relation(s) |
| N2-(3-carboxylatopropionyl)-L-arginine(1−) (CHEBI:58241) is conjugate base of N2-succinyl-L-arginine (CHEBI:17705) |
| IUPAC Names |
|---|
| (2S)-5-carbamimidamido-2-[(3-carboxypropanoyl)amino]pentanoic acid |
| N2-(3-carboxypropanoyl)-L-arginine |
| Synonyms | Source |
|---|---|
| (2S)-2-(3-Carboxypropanoylamino)-5-(diaminomethylideneamino)pentanoic acid | KEGG COMPOUND |
| Nα-succinyl-L-arginine | ChEBI |
| N2-Succinyl-L-arginine | KEGG COMPOUND |
| succinyl-arginine | ChEBI |
| succinylarginine | ChEBI |