EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29NO3 |
| Net Charge | 0 |
| Average Mass | 343.467 |
| Monoisotopic Mass | 343.21474 |
| SMILES | [H][C@@]12Cc3ccc(O)cc3[C@]3(CCCC[C@]31O)CCN2CC1CC(O)C1 |
| InChI | InChI=1S/C21H29NO3/c23-16-4-3-15-11-19-21(25)6-2-1-5-20(21,18(15)12-16)7-8-22(19)13-14-9-17(24)10-14/h3-4,12,14,17,19,23-25H,1-2,5-11,13H2/t14?,17?,19-,20+,21-/m1/s1 |
| InChIKey | NCMXKIHJYUFTRL-UJKGXUCZSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydroxybutorphanol (CHEBI:177049) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1S,9R,10S)-17-[(3-hydroxycyclobutyl)methyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol |