EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:177047 - velutin
| Formula | C17H14O6 |
| Net Charge | 0 |
| Average Mass | 314.293 |
| Monoisotopic Mass | 314.07904 |
| SMILES | COc1cc(O)c2c(=O)cc(-c3ccc(O)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C17H14O6/c1-21-10-6-12(19)17-13(20)8-14(23-16(17)7-10)9-3-4-11(18)15(5-9)22-2/h3-8,18-19H,1-2H3 |
| InChIKey | ROCUOVBWAWAQFD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chrysolaena flexuosa (ncbitaxon:211152) | - | PubMed (1144213) | Species also known as Vernonia flexuosa. |
| Xylosma velutina (IPNI:1107522-2) | - | DOI (10.1016/S0031-9422(00)88804-4) | |
| Euterpe oleracea (ncbitaxon:115466) | - | PubMed (22137267) | |
| Drimys arfakensis (IPNI:554371-1) | bark (BTO:0001301) | DOI (10.18502/kls.v3i5.978) | Isolated from stem bark. |
| Vernonanthura nudiflora (ncbitaxon:2067325) | flower (BTO:0000469) | PubMed (34558351) | |
| Polydora serratuloides (IPNI:1010921-1) | leaf (BTO:0000713) | PubMed (32162535) | |
| Combretum fragrans (IPNI:170088-1) | leaf (BTO:0000713) | PubMed (29451865) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. anti-allergic agent A drug used to treat allergic reactions. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| velutin (CHEBI:177047) has functional parent 4',5,7-trihydroxy-3'-methoxyflavone (CHEBI:16514) |
| velutin (CHEBI:177047) has role anti-allergic agent (CHEBI:50857) |
| velutin (CHEBI:177047) has role anti-inflammatory agent (CHEBI:67079) |
| velutin (CHEBI:177047) has role antibacterial agent (CHEBI:33282) |
| velutin (CHEBI:177047) has role antioxidant (CHEBI:22586) |
| velutin (CHEBI:177047) has role melanin synthesis inhibitor (CHEBI:64933) |
| velutin (CHEBI:177047) has role plant metabolite (CHEBI:76924) |
| velutin (CHEBI:177047) is a dihydroxyflavone (CHEBI:38686) |
| velutin (CHEBI:177047) is a dimethoxyflavone (CHEBI:23798) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxychromen-4-one | ChEBI |
| 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one | IUPAC |
| 5,4'-dihydroxy-7,3'-dimethoxyflavone | ChEBI |
| luteolin 7,3'-dimethyl ether | LIPID MAPS |
| flavoyadorigenin B | LIPID MAPS |
| UniProt Name | Source |
|---|---|
| velutin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMPK12111053 | LIPID MAPS |
| 4576639 | ChemSpider |
| C00003867 | KNApSAcK |
| Velutin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:25739-41-7 | ChemIDplus |
| Citations |
|---|