EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H58O2 |
| Net Charge | 0 |
| Average Mass | 450.792 |
| Monoisotopic Mass | 450.44368 |
| SMILES | CCCCCCCCCC(=O)OC/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C30H58O2/c1-7-8-9-10-11-12-13-23-30(31)32-25-24-29(6)22-16-21-28(5)20-15-19-27(4)18-14-17-26(2)3/h24,26-28H,7-23,25H2,1-6H3/b29-24+/t27-,28-/m1/s1 |
| InChIKey | VQNBYXCYEWSWMZ-JNXGHUNNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centaurea scabiosa (ncbitaxon:145517) | flower (BTO:0000469) | PubMed (34201790) |
| Roles Classification |
|---|
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caprate phytyl ester (CHEBI:177028) has functional parent decanoic acid (CHEBI:30813) |
| caprate phytyl ester (CHEBI:177028) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| caprate phytyl ester (CHEBI:177028) is a fatty acid phytyl ester (CHEBI:177021) |
| IUPAC Name |
|---|
| (2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl decanoate |
| Synonyms | Source |
|---|---|
| (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl decanoate | ChEBI |
| (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl decanoic acid ester | ChEBI |
| decanoate phytyl ester | ChEBI |
| phytyl caprate | ChEBI |
| phytyl decanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| decanoate phytyl ester | UniProt |
| Citations |
|---|