EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H66O2 |
| Net Charge | 0 |
| Average Mass | 506.900 |
| Monoisotopic Mass | 506.50628 |
| SMILES | CCCCCCCCCCCCCC(=O)OC/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C34H66O2/c1-7-8-9-10-11-12-13-14-15-16-17-27-34(35)36-29-28-33(6)26-20-25-32(5)24-19-23-31(4)22-18-21-30(2)3/h28,30-32H,7-27,29H2,1-6H3/b33-28+/t31-,32-/m1/s1 |
| InChIKey | QYGFRANKWSAZOD-NTGYCHQQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon coetsa (ncbitaxon:204131) | leaf (BTO:0000713) | Article (Jianzhong, W. and Fengpeng, W. (1998) Chemical study of Rabdosia coetsa. Natural Product Research and Development, 10(3), 15-20.) | Species also known as Rabdosia coetsa. |
| Roles Classification |
|---|
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myristate phytyl ester (CHEBI:177026) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| myristate phytyl ester (CHEBI:177026) is a fatty acid phytyl ester (CHEBI:177021) |
| myristate phytyl ester (CHEBI:177026) is a tetradecanoate ester (CHEBI:87691) |
| IUPAC Name |
|---|
| (2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl tetradecanoate |
| Synonyms | Source |
|---|---|
| (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl tetradecanoate | ChEBI |
| (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl tetradecanoic acid ester | ChEBI |
| phytyl myristate | ChemIDplus |
| phytyl tetradecanoate | ChemIDplus |
| tetradecanoate phytyl ester | ChEBI |
| UniProt Name | Source |
|---|---|
| tetradecanoate phytyl ester | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 57451830 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:62172-52-5 | ChemIDplus |
| Citations |
|---|