EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23NO4 |
| Net Charge | 0 |
| Average Mass | 281.352 |
| Monoisotopic Mass | 281.16271 |
| SMILES | CC(C)=CC/C=C(/C)[C@H]1CN[C@H](C(=O)O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C15H23NO4/c1-9(2)5-4-6-10(3)12-8-16-14(15(19)20)11(12)7-13(17)18/h5-6,11-12,14,16H,4,7-8H2,1-3H3,(H,17,18)(H,19,20)/b10-6-/t11-,12+,14-/m0/s1 |
| InChIKey | GSLRBTJVJMDETK-LCZAJGKFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chondria armata (ncbitaxon:860625) | - | PubMed ( 29321590) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dainic acid A (CHEBI:177025) has role algal metabolite (CHEBI:84735) |
| dainic acid A (CHEBI:177025) has role marine metabolite (CHEBI:76507) |
| dainic acid A (CHEBI:177025) is a L-proline derivative (CHEBI:84186) |
| dainic acid A (CHEBI:177025) is a dicarboxylic acid (CHEBI:35692) |
| dainic acid A (CHEBI:177025) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| dainic acid A (CHEBI:177025) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| dainic acid A (CHEBI:177025) is conjugate acid of dainate A(1−) (CHEBI:176974) |
| Incoming Relation(s) |
| dainate A(1−) (CHEBI:176974) is conjugate base of dainic acid A (CHEBI:177025) |
| IUPAC Name |
|---|
| (3S,4S)-3-(carboxymethyl)-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]-L-proline |
| Synonyms | Source |
|---|---|
| (2S,3S,4S)-3-(carboxymethyl)-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]pyrrolidine-2-carboxylic acid | IUPAC |
| 7'-methyl-isodomoic acid A | ChEBI |
| 7'-methylisodomoic acid A | ChEBI |
| Citations |
|---|